| Primary information |
|---|
| PRRID | PRRID_0295 |
| Ligand Name | Hyaluronan |
| Source | Sperm-secreted hyaluronidase (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Hyaluronan fragments or hyaluronidase activates the NFκB pathway and induced Il6, Ccl4 and Ccl5 mRNA expression. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Ovulated Cumulus-Oocyte Complexes(COCs) |
| Domain | LRR |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | The chemokines secreted from COCs induced sperm capacitation and enhanced fertilization. |
| Assay used | Sperm accumulation assay |
| PMID | 18434414 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0295 |
| Ligand Name | Hyaluronan |
| Source | Sperm-secreted hyaluronidase (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Hyaluronan fragments or hyaluronidase activates the NFκB pathway and induced Il6, Ccl4 and Ccl5 mRNA expression. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Ovulated Cumulus-Oocyte Complexes(COCs) |
| Domain | LRR |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | The chemokines secreted from COCs induced sperm capacitation and enhanced fertilization. |
| Assay used | Sperm accumulation assay |
| PMID | 18434414 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |