| Primary information |
|---|
| PRRID | PRRID_0289 |
| Ligand Name | Gardiquimod |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCNCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Upon ligand engagement TLR proteins trigger downstream cellular signaling, leading to the activation of NF- |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Porcine |
| Localization | Lymph node tissue |
| Domain | LRR |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has a immunostimulatory role |
| Assay used | NF- |
| PMID | 18439678 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0289 |
| Ligand Name | Gardiquimod |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCNCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Upon ligand engagement TLR proteins trigger downstream cellular signaling, leading to the activation of NF- |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Porcine |
| Localization | Lymph node tissue |
| Domain | LRR |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has a immunostimulatory role |
| Assay used | NF- |
| PMID | 18439678 |
| Year of Publication | 2008 |
| Pubchem assay | NA |