| Primary information |
|---|
| PRRID | PRRID_0277 |
| Ligand Name | CL097 |
| Source | NA |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces astrocyte activation and up-regulation of proinflammatory cytokines and chemokines, including IFN- |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Newborn Mice |
| Localization | Astrocytes and microglia |
| Domain | LRR |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It induces a neuroinflammatory response in CNS. |
| Assay used | Cytokines assay |
| PMID | 18490763 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0277 |
| Ligand Name | CL097 |
| Source | NA |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces astrocyte activation and up-regulation of proinflammatory cytokines and chemokines, including IFN- |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Newborn Mice |
| Localization | Astrocytes and microglia |
| Domain | LRR |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It induces a neuroinflammatory response in CNS. |
| Assay used | Cytokines assay |
| PMID | 18490763 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |