| Primary information |
|---|
| PRRID | PRRID_0186 |
| Ligand Name | Resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Resisuimod activates the MyD88-dependent TLR/IL-1R signaling pathway and induces the cytokine production. |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Spleenocytes |
| Domain | NA |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It leads to the endosomal maturation. |
| Assay used | ELISA |
| PMID | 14579267 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0186 |
| Ligand Name | Resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Resisuimod activates the MyD88-dependent TLR/IL-1R signaling pathway and induces the cytokine production. |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Spleenocytes |
| Domain | NA |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It leads to the endosomal maturation. |
| Assay used | ELISA |
| PMID | 14579267 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |