| Primary information |
|---|
| PRRID | PRRID_0175 |
| Ligand Name | Lewis x |
| Source | S. mansoni (others) |
| Sequence of ligand | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)CO)O)NC(=O)C)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Synthetic |
| Role of Ligand | It strongly binds to the DC-SIGN. |
| Name of receptor | DC-SIGN |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | K562 cells |
| Localization | Dendritic cells |
| Domain | Lectin domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It induces the pathogen-driven inflammatory responses. |
| Assay used | ELISA |
| PMID | 12574325 |
| Year of Publication | 2003 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0175 |
| Ligand Name | Lewis x |
| Source | S. mansoni (others) |
| Sequence of ligand | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)CO)O)NC(=O)C)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Synthetic |
| Role of Ligand | It strongly binds to the DC-SIGN. |
| Name of receptor | DC-SIGN |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | K562 cells |
| Localization | Dendritic cells |
| Domain | Lectin domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It induces the pathogen-driven inflammatory responses. |
| Assay used | ELISA |
| PMID | 12574325 |
| Year of Publication | 2003 |
| Pubchem assay | NA |