| Primary information |
|---|
| PRRID | PRRID_0163 |
| Ligand Name | C12-iE-DAP |
| Source | Chemical derivative of iE-DAP(others) |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Peptide |
| Occurence | Synthetic |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice (Murine) |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | mediates selective recognition of bacteria through detection of iE-DAP-containing peptidoglycan. |
| Assay used | ELISA |
| PMID | 12796777 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0163 |
| Ligand Name | C12-iE-DAP |
| Source | Chemical derivative of iE-DAP(others) |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Peptide |
| Occurence | Synthetic |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice (Murine) |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | mediates selective recognition of bacteria through detection of iE-DAP-containing peptidoglycan. |
| Assay used | ELISA |
| PMID | 12796777 |
| Year of Publication | 2003 |
| Pubchem assay | Pubchem Assay |