Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0131 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0131 |
| Ligand Name | Hyaluronic acid |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | potent activators of immunocompetent cells such as dendritic cells (DCs) and macrophages |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Bone Marrow–derived DCs |
| Domain | transmembrane domain that associates with the intra- cellular adaptor protein MyD88 |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 11781369 |
| Year of Publication | 2002 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0131 |
| Ligand Name | Hyaluronic acid |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | potent activators of immunocompetent cells such as dendritic cells (DCs) and macrophages |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Bone Marrow–derived DCs |
| Domain | transmembrane domain that associates with the intra- cellular adaptor protein MyD88 |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | TLR 4 leads to an intracellular signaling pathway NF-κB and inflammatory cytokine production which is responsible for activating the innate immune system |
| Assay used | ELISA |
| PMID | 11781369 |
| Year of Publication | 2002 |
| Pubchem assay | Pubchem Assay |