Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0116 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0116 |
| Ligand Name | Fragments of heparan sulphate |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | COC1C(C(C(OC1C(=O)[O-])OC2C(OC(C(C2[O-])NOS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Proteoglycan |
| Occurence | Natural |
| Role of Ligand | Heparan sulfate induces nuclear translocation of NF-kappaB. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Bone-Marrow culture |
| Domain | NA |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | TLR4 plays the role in the activation and maturation of dendritic cells, thus suggesting that vertebrate TLR monitor perturbations to the well-being of tissues. |
| Assay used | EMSA |
| PMID | 11994480 |
| Year of Publication | 2002 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0116 |
| Ligand Name | Fragments of heparan sulphate |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | COC1C(C(C(OC1C(=O)[O-])OC2C(OC(C(C2[O-])NOS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Proteoglycan |
| Occurence | Natural |
| Role of Ligand | Heparan sulfate induces nuclear translocation of NF-kappaB. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Bone-Marrow culture |
| Domain | NA |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | TLR4 plays the role in the activation and maturation of dendritic cells, thus suggesting that vertebrate TLR monitor perturbations to the well-being of tissues. |
| Assay used | EMSA |
| PMID | 11994480 |
| Year of Publication | 2002 |
| Pubchem assay | Pubchem Assay |