| Primary information |
|---|
| PRRID | PRRID_0111 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces the activation of NF-kappaB and secretion of type I IFNs, IFN-alpha and IFN-beta and cytokines IL-6 and IL-12. |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | (HEK293 t cells) |
| Domain | NA |
| Sequence of Receptor | O15455.fasta |
| Swiss prot ID | O15455 |
| Length Of Receptor | 904 |
| Function | IFNs inhibit virus replication, IL-6 and IL-12, which are also induced by bacterial infections, elicit cytotoxic responses needed for elimination of intracellular pathogens. |
| Assay used | EMSA |
| PMID | 11607032 |
| Year of Publication | 2001 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0111 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces the activation of NF-kappaB and secretion of type I IFNs, IFN-alpha and IFN-beta and cytokines IL-6 and IL-12. |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | (HEK293 t cells) |
| Domain | NA |
| Sequence of Receptor | O15455.fasta |
| Swiss prot ID | O15455 |
| Length Of Receptor | 904 |
| Function | IFNs inhibit virus replication, IL-6 and IL-12, which are also induced by bacterial infections, elicit cytotoxic responses needed for elimination of intracellular pathogens. |
| Assay used | EMSA |
| PMID | 11607032 |
| Year of Publication | 2001 |
| Pubchem assay | Pubchem Assay |