| Primary information |
|---|
| PRRID | PRRID_0092 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Ox-LDL binds with SR-PSOX with high affinity. |
| Name of receptor | Scavenger receptor PSOX (SR-PSOX) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Human |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9H2A7.fasta |
| Swiss prot ID | Q9H2A7 |
| Length Of Receptor | 254 |
| Function | SR-PSOX specifically binds with high affinity, internalize and degrade OxLDL, hence play important roles in pathophysiology including atherogenesis. |
| Assay used | ELISA |
| PMID | 11060282 |
| Year of Publication | 2000 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0092 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Ox-LDL binds with SR-PSOX with high affinity. |
| Name of receptor | Scavenger receptor PSOX (SR-PSOX) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Human |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q9H2A7.fasta |
| Swiss prot ID | Q9H2A7 |
| Length Of Receptor | 254 |
| Function | SR-PSOX specifically binds with high affinity, internalize and degrade OxLDL, hence play important roles in pathophysiology including atherogenesis. |
| Assay used | ELISA |
| PMID | 11060282 |
| Year of Publication | 2000 |
| Pubchem assay | Pubchem Assay |