Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0089 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0089 |
| Ligand Name | Murabutide |
| Source | MDP (others) |
| Sequence of ligand | CCCCOC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Synthetic |
| Role of Ligand | Stimulation with murabutide leads to the significant release of TNF-a, IL-6, MIP-1a, MIP-1b, RANTES and high levels of beta-chemokines. |
| Name of receptor | NA |
| Type of receptor | NA |
| Source | Human |
| Localization | Monocytes-derived macrophages and dendritic cells |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Murabutide has the capacity to enhance nonspecific resistance against viral infections and to target cells of the reticuloendothelial system. |
| Assay used | ELISA |
| PMID | 10933686 |
| Year of Publication | 2000 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_0089 |
| Ligand Name | Murabutide |
| Source | MDP (others) |
| Sequence of ligand | CCCCOC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Synthetic |
| Role of Ligand | Stimulation with murabutide leads to the significant release of TNF-a, IL-6, MIP-1a, MIP-1b, RANTES and high levels of beta-chemokines. |
| Name of receptor | NA |
| Type of receptor | NA |
| Source | Human |
| Localization | Monocytes-derived macrophages and dendritic cells |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Murabutide has the capacity to enhance nonspecific resistance against viral infections and to target cells of the reticuloendothelial system. |
| Assay used | ELISA |
| PMID | 10933686 |
| Year of Publication | 2000 |
| Pubchem assay | NA |