| Primary information |
|---|
| PRRID | PRRID_0079 |
| Ligand Name | Chondroitin Sulfates A |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)OS(=O)(=O)O)OC2C(C(C(C(O2)C(=O)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Chondroitin Sulfates A binds to mannose receptor via a membrane-distal cysteine-rich domain (Cys-MR). |
| Name of receptor | Cys-MR |
| Type of receptor | Mannose receptor (MR) |
| Source | Human |
| Localization | Spleenocytes |
| Domain | carbohydrate-recognition domain (CRD) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | The Cysteine-rich Domain of the Macrophage Mannose Receptor Is a Multispecific Lectin That Recognizes Chondroitin Sulfates A and B and Sulfated Oligosaccharides of Blood Group. |
| Assay used | NA |
| PMID | 10748230 |
| Year of Publication | 2000 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0079 |
| Ligand Name | Chondroitin Sulfates A |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)OS(=O)(=O)O)OC2C(C(C(C(O2)C(=O)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Chondroitin Sulfates A binds to mannose receptor via a membrane-distal cysteine-rich domain (Cys-MR). |
| Name of receptor | Cys-MR |
| Type of receptor | Mannose receptor (MR) |
| Source | Human |
| Localization | Spleenocytes |
| Domain | carbohydrate-recognition domain (CRD) |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | The Cysteine-rich Domain of the Macrophage Mannose Receptor Is a Multispecific Lectin That Recognizes Chondroitin Sulfates A and B and Sulfated Oligosaccharides of Blood Group. |
| Assay used | NA |
| PMID | 10748230 |
| Year of Publication | 2000 |
| Pubchem assay | NA |