| Primary information |
|---|
| PRRID | PRRID_0074 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Peptidoglycan recognition by TLR 2 leads to the activation of NF-KB, which leads to the secretion of proinflammatory cytokines. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Fibroblasts |
| Domain | LRR |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | TLR2 is responsible for recognzing the cell wall components of the gram-positive bacteria and induces the respective immune response. |
| Assay used | EMSA |
| PMID | 10384090 |
| Year of Publication | 1999 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0074 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Peptidoglycan recognition by TLR 2 leads to the activation of NF-KB, which leads to the secretion of proinflammatory cytokines. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Fibroblasts |
| Domain | LRR |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | TLR2 is responsible for recognzing the cell wall components of the gram-positive bacteria and induces the respective immune response. |
| Assay used | EMSA |
| PMID | 10384090 |
| Year of Publication | 1999 |
| Pubchem assay | Pubchem Assay |