| Primary information |
|---|
| PRRID | PRRID_0070 |
| Ligand Name | Minimally oxidized LDL (MM-LDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | MM-LDL pretreatment induced a clear increase of cell association and increase both mRNAlevels and protein levels of scavenger receptor A, CD36, and macrosialin. |
| Name of receptor | Microsialin |
| Type of receptor | Scavenger receptor (SR) |
| Source | Mice |
| Localization | Peritoneal macrophages |
| Domain | NA |
| Sequence of Receptor | A0A0R4J1C8.fasta |
| Swiss prot ID | A0A0R4J1C8 |
| Length Of Receptor | 335 |
| Function | It leads to the binding and uptake of oxidised form of LDL by resident mouse peritoneal macrophages. |
| Assay used | Endocytic degradation assays |
| PMID | 9598839 |
| Year of Publication | 1998 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0070 |
| Ligand Name | Minimally oxidized LDL (MM-LDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | MM-LDL pretreatment induced a clear increase of cell association and increase both mRNAlevels and protein levels of scavenger receptor A, CD36, and macrosialin. |
| Name of receptor | Microsialin |
| Type of receptor | Scavenger receptor (SR) |
| Source | Mice |
| Localization | Peritoneal macrophages |
| Domain | NA |
| Sequence of Receptor | A0A0R4J1C8.fasta |
| Swiss prot ID | A0A0R4J1C8 |
| Length Of Receptor | 335 |
| Function | It leads to the binding and uptake of oxidised form of LDL by resident mouse peritoneal macrophages. |
| Assay used | Endocytic degradation assays |
| PMID | 9598839 |
| Year of Publication | 1998 |
| Pubchem assay | Pubchem Assay |