| Primary information |
|---|
| PRRID | PRRID_0068 |
| Ligand Name | High Density Lipoprotein (HDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | CD36 is a high affinity receptor for the native lipoproteins LDL. |
| Name of receptor | cluster of differentiation 36 (CD36) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Human |
| Localization | Monocytes/Macrophages |
| Domain | NA |
| Sequence of Receptor | P16671.fasta |
| Swiss prot ID | P16671 |
| Length Of Receptor | 472 |
| Function | Lipoprotein binding assay |
| Assay used | NA |
| PMID | 9555943 |
| Year of Publication | 1998 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0068 |
| Ligand Name | High Density Lipoprotein (HDL) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | CD36 is a high affinity receptor for the native lipoproteins LDL. |
| Name of receptor | cluster of differentiation 36 (CD36) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Human |
| Localization | Monocytes/Macrophages |
| Domain | NA |
| Sequence of Receptor | P16671.fasta |
| Swiss prot ID | P16671 |
| Length Of Receptor | 472 |
| Function | Lipoprotein binding assay |
| Assay used | NA |
| PMID | 9555943 |
| Year of Publication | 1998 |
| Pubchem assay | Pubchem Assay |