| Primary information |
|---|
| PRRID | PRRID_0064 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Scavenger receptor A II |
| Type of receptor | Scavenger receptor (SR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q08857.fasta |
| Swiss prot ID | Q08857 |
| Length Of Receptor | 472 |
| Function | production of pro-inflammatory cytokines |
| Assay used | NA |
| PMID | 9069289 |
| Year of Publication | 1997 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0064 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Scavenger receptor A II |
| Type of receptor | Scavenger receptor (SR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | Q08857.fasta |
| Swiss prot ID | Q08857 |
| Length Of Receptor | 472 |
| Function | production of pro-inflammatory cytokines |
| Assay used | NA |
| PMID | 9069289 |
| Year of Publication | 1997 |
| Pubchem assay | Pubchem Assay |