| Primary information |
|---|
| PRRID | PRRID_0063 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Lectin-like oxidized LDLreceptor 1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | NA |
| Localization | vascular endothelium and vascular-rich organs. |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 9052782 |
| Year of Publication | 1997 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0063 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Lectin-like oxidized LDLreceptor 1 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | NA |
| Localization | vascular endothelium and vascular-rich organs. |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 9052782 |
| Year of Publication | 1997 |
| Pubchem assay | NA |