Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0062 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0062 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Scavenger receptor expressed by endothelial cells 1 |
| Type of receptor | Scavenger receptor (SR) |
| Source | Chinese Hamster |
| Localization | Chinese hamster ovary cells |
| Domain | Lectin-like domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | ELISA |
| PMID | 9395444 |
| Year of Publication | 1997 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_0062 |
| Ligand Name | oxidized LDL (OxLDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | Scavenger receptor expressed by endothelial cells 1 |
| Type of receptor | Scavenger receptor (SR) |
| Source | Chinese Hamster |
| Localization | Chinese hamster ovary cells |
| Domain | Lectin-like domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | ELISA |
| PMID | 9395444 |
| Year of Publication | 1997 |
| Pubchem assay | NA |