| Primary information |
|---|
| PRRID | PRRID_0049 |
| Ligand Name | Fractionated [(3)H]heparin |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)COS(=O)(=O)O)OC2C(C(C(C(O2)C(=O)O)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O)NS(=O)(=O)O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | Fractionated [(3)H]heparin is a potent ligand for scavenger receptor A-I |
| Name of receptor | Scavenger receptor A I (SR-A I) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Rat |
| Localization | Kupffer cells |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Adsorptive endocytosis of polypeptides and phagocytosis. |
| Assay used | NA |
| PMID | 8860963 |
| Year of Publication | 1996 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0049 |
| Ligand Name | Fractionated [(3)H]heparin |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)COS(=O)(=O)O)OC2C(C(C(C(O2)C(=O)O)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O)NS(=O)(=O)O)O)OS(=O)(=O)O)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | Fractionated [(3)H]heparin is a potent ligand for scavenger receptor A-I |
| Name of receptor | Scavenger receptor A I (SR-A I) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Rat |
| Localization | Kupffer cells |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Adsorptive endocytosis of polypeptides and phagocytosis. |
| Assay used | NA |
| PMID | 8860963 |
| Year of Publication | 1996 |
| Pubchem assay | NA |