Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0034 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0034 |
| Ligand Name | Acetylated LDL |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Acetylated-LDL is a potent activator of MSR. |
| Name of receptor | Macrophage Scavenger Receptor (MSR) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Human |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | P21757.fasta |
| Swiss prot ID | P21757 |
| Length Of Receptor | 451 |
| Function | The MSR mediates the endocytic uptake and degradation of LDL. |
| Assay used | NA |
| PMID | 7607209 |
| Year of Publication | 1995 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0034 |
| Ligand Name | Acetylated LDL |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Acetylated-LDL is a potent activator of MSR. |
| Name of receptor | Macrophage Scavenger Receptor (MSR) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Human |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | P21757.fasta |
| Swiss prot ID | P21757 |
| Length Of Receptor | 451 |
| Function | The MSR mediates the endocytic uptake and degradation of LDL. |
| Assay used | NA |
| PMID | 7607209 |
| Year of Publication | 1995 |
| Pubchem assay | Pubchem Assay |