| Primary information |
|---|
| PRRID | PRRID_0033 |
| Ligand Name | Acetylated LDL |
| Source | NA |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Acetylated LDL is a potent ligand for MARCO |
| Name of receptor | Macrophage receptor with collagenous structure (MARCO) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | A2RT24.fasta |
| Swiss prot ID | A2RT24 |
| Length Of Receptor | 518 |
| Function | It plays a role in immunological reactions. |
| Assay used | Immunoprecipitation |
| PMID | 7867067 |
| Year of Publication | 1995 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0033 |
| Ligand Name | Acetylated LDL |
| Source | NA |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Acetylated LDL is a potent ligand for MARCO |
| Name of receptor | Macrophage receptor with collagenous structure (MARCO) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Mice |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | A2RT24.fasta |
| Swiss prot ID | A2RT24 |
| Length Of Receptor | 518 |
| Function | It plays a role in immunological reactions. |
| Assay used | Immunoprecipitation |
| PMID | 7867067 |
| Year of Publication | 1995 |
| Pubchem assay | Pubchem Assay |