Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0032 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0032 |
| Ligand Name | Acetylated LDL |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | dSR-C1 |
| Type of receptor | Scavenger receptor (SR) |
| Source | Drosophila melanogaster |
| Localization | NA |
| Domain | two complement control protein (CCP) domains and somatomedin B, MAM, and mucin-like domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 7732030 |
| Year of Publication | 1995 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_0032 |
| Ligand Name | Acetylated LDL |
| Source | Endogenous (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | dSR-C1 |
| Type of receptor | Scavenger receptor (SR) |
| Source | Drosophila melanogaster |
| Localization | NA |
| Domain | two complement control protein (CCP) domains and somatomedin B, MAM, and mucin-like domains |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 7732030 |
| Year of Publication | 1995 |
| Pubchem assay | NA |