Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0027 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0027 |
| Ligand Name | poly(I:G) |
| Source | synthetic oligonucleotide (others) |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Scavenger receptor A II |
| Type of receptor | Scavenger receptor (SR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | ELISA |
| PMID | 8429030 |
| Year of Publication | 1993 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_0027 |
| Ligand Name | poly(I:G) |
| Source | synthetic oligonucleotide (others) |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Immunostimulant |
| Name of receptor | Scavenger receptor A II |
| Type of receptor | Scavenger receptor (SR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | ELISA |
| PMID | 8429030 |
| Year of Publication | 1993 |
| Pubchem assay | NA |