| Primary information |
|---|
| PRRID | PRRID_0024 |
| Ligand Name | High Density Lipoprotein (HDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | cluster of differentiation 36 (CD36) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 7685021 |
| Year of Publication | 1993 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0024 |
| Ligand Name | High Density Lipoprotein (HDL) |
| Source | Endogenous (others) |
| Sequence of ligand | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | Immunostimulant |
| Name of receptor | cluster of differentiation 36 (CD36) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 7685021 |
| Year of Publication | 1993 |
| Pubchem assay | NA |