| Primary information |
|---|
| PRRID | PRRID_0014 |
| Ligand Name | N-acetylmannosamine |
| Source | Bacteria |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Mannose receptor |
| Type of receptor | Mannose receptor (MR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | P22897.fasta |
| Swiss prot ID | P22897 |
| Length Of Receptor | 1456 |
| Function | Induces pro-inflammatory cytokine response |
| Assay used | NA |
| PMID | 1906888 |
| Year of Publication | 1991 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0014 |
| Ligand Name | N-acetylmannosamine |
| Source | Bacteria |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Mannose receptor |
| Type of receptor | Mannose receptor (MR) |
| Source | Human |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | P22897.fasta |
| Swiss prot ID | P22897 |
| Length Of Receptor | 1456 |
| Function | Induces pro-inflammatory cytokine response |
| Assay used | NA |
| PMID | 1906888 |
| Year of Publication | 1991 |
| Pubchem assay | Pubchem Assay |