| Primary information |
|---|
| PRRID | PRRID_0012 |
| Ligand Name | Fucoidan |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It Stimulates the secretion of urokinasetype plasminogen activator (uPA) in Protein Kinase-C (PKC) dependent manner. |
| Name of receptor | Scavenger receptor class A |
| Type of receptor | Scavenger receptor (SR) |
| Source | Macrophage cell line (RAW264) |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to polyanion-induced macrophage plasminogen activation. |
| Assay used | Functional assay for plasmin |
| PMID | 1658006 |
| Year of Publication | 1991 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0012 |
| Ligand Name | Fucoidan |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It Stimulates the secretion of urokinasetype plasminogen activator (uPA) in Protein Kinase-C (PKC) dependent manner. |
| Name of receptor | Scavenger receptor class A |
| Type of receptor | Scavenger receptor (SR) |
| Source | Macrophage cell line (RAW264) |
| Localization | Macrophages |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to polyanion-induced macrophage plasminogen activation. |
| Assay used | Functional assay for plasmin |
| PMID | 1658006 |
| Year of Publication | 1991 |
| Pubchem assay | NA |