| Primary information |
|---|
| PRRID | PRRID_0005 |
| Ligand Name | Fucoidan |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Scavenger receptor A I (SR-A I) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Bovine |
| Localization | smooth muscle cells |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 3397384 |
| Year of Publication | 1988 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0005 |
| Ligand Name | Fucoidan |
| Source | NA |
| Sequence of ligand | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | elicit innate immune response |
| Name of receptor | Scavenger receptor A I (SR-A I) |
| Type of receptor | Scavenger receptor (SR) |
| Source | Bovine |
| Localization | smooth muscle cells |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 3397384 |
| Year of Publication | 1988 |
| Pubchem assay | NA |