| Primary information |
|---|
| PRRID | PRRID_0002 |
| Ligand Name | N-acetylmuramyl-L-alanyl-D-isoglutamine (MDP) |
| Source | NA |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Synthetic |
| Role of Ligand | It leads to the induction of interferon in the lung. |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Sendai virus infected mice |
| Localization | Lungs |
| Domain | NA |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | It augments host-resistance to viral infection. |
| Assay used | Interferon assay |
| PMID | 2417426 |
| Year of Publication | 1985 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0002 |
| Ligand Name | N-acetylmuramyl-L-alanyl-D-isoglutamine (MDP) |
| Source | NA |
| Sequence of ligand | CC(C(=O)NC(CCC(=O)O)C(=O)N)NC(=O)C(C)OC1C(C(OC(C1O)CO)O)NC(=O)C |
| Length | NA |
| Type | Peptide |
| Occurence | Synthetic |
| Role of Ligand | It leads to the induction of interferon in the lung. |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 2 (Nod2) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Sendai virus infected mice |
| Localization | Lungs |
| Domain | NA |
| Sequence of Receptor | Q8K3Z0.fasta |
| Swiss prot ID | Q8K3Z0 |
| Length Of Receptor | 1020 |
| Function | It augments host-resistance to viral infection. |
| Assay used | Interferon assay |
| PMID | 2417426 |
| Year of Publication | 1985 |
| Pubchem assay | Pubchem Assay |