Welcome to Entry Card of Peptide
Details of SAPdb ID 2049 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 2049 | |
| PMID | 29138048 | |
| Year | 2017 | |
| Name | CHT-CM-AA | |
| Sequence | AA | |
| N-Terminal Modification | CHT-CM | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Conjugate | |
| Conjugate Partner | CHT-CM | |
| Technique | Fourier transform infrared spectroscopy, NMR | |
| Solvent | DMF and H2O | |
| Method | NA | |
| Concentration | 19:1 | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 4 h | |
| Self-Assembly Formation | NA | |
| Type of Self-Assembly | Nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O | |