Details of SAPdb ID 2021 |
Primary information | ||
---|---|---|
SAPdb_ID | 2021 | |
PMID | 29018249 | |
Year | 2017 | |
Name | acetylated Ile-Val-Asp (Ac-IVD) | |
Sequence | IVD | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Field emission scanning electron microscopy (FESEM) | |
Solvent | acetonitrile/water and formic acid | |
Method | NA | |
Concentration | 0.10% | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogels | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O |