Details of SAPdb ID 2016 |
Primary information | ||
---|---|---|
SAPdb_ID | 2016 | |
PMID | 28955776 | |
Year | 2017 | |
Name | H-Phe-Phe-NH2 | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | ultra- violet (UV) absorption spectroscopy, fluorescence spectroscopy, cir- cular dichroism (CD) study, viscosity measurement and thermal dena- turation analysis of DNA | |
Solvent | Tris-NaCl EDTA (TNE) buffer | |
Method | NA | |
Concentration | NA | |
pH | 7.4 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanotubes and vesicle-like structures | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |