Welcome to Entry Card of Peptide
Details of SAPdb ID 2013 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 2013 | |
| PMID | 28955776 | |
| Year | 2017 | |
| Name | H-Phe- Phe-Phe-OH (FFF) | |
| Sequence | FFF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | ultraviolet (UV) absorption spectroscopy, fluorescence spectroscopy and circular dichroism (CD) spectroscopy | |
| Solvent | Tris-NaCl EDTA (TNE) buffer | |
| Method | NA | |
| Concentration | NA | |
| pH | 7.4 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | nanostructured aggregates | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | NA | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |