Welcome to Entry Card of Peptide
Details of SAPdb ID 2012 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 2012 | |
| PMID | 28900508 | |
| Year | 2017 | |
| Name | N-acetyl Pro-Gly-Pro (Ac-PGP) | |
| Sequence | PGP | |
| N-Terminal Modification | Acetylation | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | confocal microscopy and TEM | |
| Solvent | PBS | |
| Method | NA | |
| Concentration | 5:1 molar ratio | |
| pH | 7.4 | |
| Temperature | Room temperature | |
| Incubation Period | 1 h | |
| Self-Assembly Formation | No | |
| Type of Self-Assembly | NA | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | NA | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O | |