Details of SAPdb ID 2011 |
Primary information | ||
---|---|---|
SAPdb_ID | 2011 | |
PMID | 28884061 | |
Year | 2017 | |
Name | DLeu-Phe-Phe | |
Sequence | LFF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | rheometry, fluorescence, circular dichro- ism (CD), FTIR spectroscopy, transmission electron microsco- py (TEM), and differential scanning calorimetry (DSC) | |
Solvent | sodium phosphate | |
Method | NA | |
Concentration | 0.1 M | |
pH | 11.8 | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Hydrogels | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |