Welcome to Entry Card of Peptide
Details of SAPdb ID 2005 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 2005 | |
| PMID | 28841256 | |
| Year | 2017 | |
| Name | FF–Hb | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Hb | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | Scanning Electron Microscopy (SEM) | |
| Solvent | GA solution and FF solution | |
| Method | NA | |
| Concentration | 250 μL of 0.25 w% GA solution into 250 μL of 16 mg/mL freshly prepared Hb and 4 mg/mL FF solution | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 4 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanospheres | |
| Size of Self-Assembled structure | 20 to 200 nm | |
| Linear/Cyclic | Cyclic | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |