Welcome to Entry Card of Peptide
Details of SAPdb ID 1991 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1991 | |
| PMID | 28825801 | |
| Year | 2017 | |
| Name | FmocFF-HAP | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | HAP | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM, HR-SEM, FTIR | |
| Solvent | 950 μL of DDW | |
| Method | sonication | |
| Concentration | 1mg/ml | |
| pH | NA | |
| Temperature | 0-4 °C | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogels | |
| Size of Self-Assembled structure | 1µm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |