Welcome to Entry Card of Peptide
Details of SAPdb ID 1988 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1988 | |
| PMID | 28825470 | |
| Year | 2017 | |
| Name | Fmoc-FF/g-C3N4 | |
| Sequence | FF | |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] | |
| C-Terminal Modification | graphitic carbon nitride (g-C3N4) | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | SEM, FE-TEM | |
| Solvent | Fmoc-FF stock solution (100 mg of Fmoc-FF was dissolved in 1 mL of HFIP) | |
| Method | NA | |
| Concentration | 100 mg/mL | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | NA | |
| Type of Self-Assembly | Hydrogels | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |