Details of SAPdb ID 1974 |
Primary information | ||
---|---|---|
SAPdb_ID | 1974 | |
PMID | 28767108 | |
Year | 2017 | |
Name | ferrocene-Phenylalanine-Phenylalanine-Phenylalanine (Fc-FFF) | |
Sequence | FFF | |
N-Terminal Modification | Ferrocene (FC) | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | confocal laser scanning microscopy (CLSM), scanning electron microscopy (SEM), transmission electron microscopy (TEM), and atomic force microscope (AFM) | |
Solvent | phosphate buffer | |
Method | NA | |
Concentration | 50 mM | |
pH | 7.2 | |
Temperature | 60 °C | |
Incubation Period | 30 s | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanovesicles | |
Size of Self-Assembled structure | 632 nm | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |