Details of SAPdb ID 1957 |
Primary information | ||
---|---|---|
SAPdb_ID | 1957 | |
PMID | 28683194 | |
Year | 2017 | |
Name | DDD-OPV3 | |
Sequence | DDD | |
N-Terminal Modification | Free | |
C-Terminal Modification | OPV3 | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | NA | |
Method | NA | |
Concentration | NA | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanostructures | |
Size of Self-Assembled structure | 200 nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O |