Welcome to Entry Card of Peptide
Details of SAPdb ID 1953 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1953 | |
| PMID | 28657720 | |
| Year | 2017 | |
| Name | DiPhenylalanine (FF) | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | Scanning Electron Microscopy (SEM) | |
| Solvent | 1,1,3,3,6,6-hexafluoro-2-propanol (HFP) | |
| Method | NA | |
| Concentration | 1 mg/mL | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 12 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Liposomes | |
| Size of Self-Assembled structure | 5µm | |
| Linear/Cyclic | Cyclic | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |