Details of SAPdb ID 1951 |
Primary information | ||
---|---|---|
SAPdb_ID | 1951 | |
PMID | 28638095 | |
Year | 2017 | |
Name | Mito-FF-NBD | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | 4-nitro-2, 1, 3-benzoxadiazole (NBD) | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | fetal bovine serum | |
Method | NA | |
Concentration | 10% | |
pH | NA | |
Temperature | 37 °C | |
Incubation Period | 24 h | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanofibres | |
Size of Self-Assembled structure | 7.1 ± 0.8 nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |