Details of SAPdb ID 1949 |
Primary information | ||
---|---|---|
SAPdb_ID | 1949 | |
PMID | 28630961 | |
Year | 2017 | |
Name | LHis-DPhe-DPhe | |
Sequence | HFF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | AFM, TEM | |
Solvent | phosphate buffer | |
Method | differential scanning calorimetry (DSC) | |
Concentration | NA | |
pH | neutral | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | No | |
Type of Self-Assembly | NA | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | NA | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CC1=CN=C-N1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |