Welcome to Entry Card of Peptide
Details of SAPdb ID 1926 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1926 | |
| PMID | 28508902 | |
| Year | 2017 | |
| Name | L-leucyl-L-leucine (Leu-Leu) | |
| Sequence | LL | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | atomic force microscopy and X-ray powder diffraction | |
| Solvent | methanol/n-butanol and methanol/acetonitrile | |
| Method | NA | |
| Concentration | 1:01 | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 3 days | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanofibres | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |