Welcome to Entry Card of Peptide
Details of SAPdb ID 1917 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1917 | |
| PMID | 28440566 | |
| Year | 2017 | |
| Name | Boc-Leu-beta 3,3 -Ac6c-Leu-beta 3,3-Ac6c-OMe, P2 | |
| Sequence | LL | |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
| C-Terminal Modification | Methoxy | |
| Non-terminal Modication | 1-Amino- cyclohexane acetic acid (beta3,3-Ac6c) | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | NA | |
| Solvent | ethyl acetate/hexane | |
| Method | NA | |
| Concentration | 8:2 | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | No | |
| Type of Self-Assembly | NA | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | NA | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |