Welcome to Entry Card of Peptide
Details of SAPdb ID 1911 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1911 | |
| PMID | 28143741 | |
| Year | 2017 | |
| Name | HA-KPV-NPs | |
| Sequence | KPV | |
| N-Terminal Modification | HA | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | hyaluronic acid (HA) | |
| Technique | flow cytometry (FCM) | |
| Solvent | MES buffer | |
| Method | NA | |
| Concentration | NA | |
| pH | 5.5 | |
| Temperature | –20°C | |
| Incubation Period | 4 hr | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanoparticles | |
| Size of Self-Assembled structure | ~272.3 nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)O | |