Welcome to Entry Card of Peptide
Details of SAPdb ID 1908 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1908 | |
| PMID | 28045258 | |
| Year | 2016 | |
| Name | Lys-Phe-Gly (KFG) | |
| Sequence | KFG | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | FT-IR, SEM and XRD | |
| Solvent | water | |
| Method | NA | |
| Concentration | 14 mM | |
| pH | 7.4 | |
| Temperature | 310 K | |
| Incubation Period | 2 ns | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanotubes | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)O | |