Details of SAPdb ID 1907 |
Primary information | ||
---|---|---|
SAPdb_ID | 1907 | |
PMID | 28045258 | |
Year | 2016 | |
Name | Lys-Phe-Gly (KFG) | |
Sequence | KFG | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | FT-IR, SEM and XRD | |
Solvent | water | |
Method | NA | |
Concentration | 1.43 mM | |
pH | 7.4 | |
Temperature | 310 K | |
Incubation Period | 2 ns | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanovesicles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Cyclic | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)O |