Welcome to Entry Card of Peptide
Details of SAPdb ID 1895 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1895 | |
| PMID | 27862690 | |
| Year | 2016 | |
| Name | Boc-L-Cys(Me)-L-Leu-OMe | |
| Sequence | CL | |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) | |
| C-Terminal Modification | Methoxy | |
| Non-terminal Modication | Me | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | Boc (tert-butyloxycarbonyl), Methyl, and methoxy (OMe) | |
| Technique | TEM, SEM and atomic force microscopy (AFM) | |
| Solvent | CH3CN/H2O | |
| Method | NA | |
| Concentration | 1:1 v/v | |
| pH | 8 | |
| Temperature | Room temperature | |
| Incubation Period | 18 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Organogel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |