Details of SAPdb ID 1887 |
Primary information | ||
---|---|---|
SAPdb_ID | 1887 | |
PMID | 27841381 | |
Year | 2016 | |
Name | FF-NH2 | |
Sequence | FF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | NH2 | |
Technique | TEM and SEM | |
Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP)/sodium phosphate buffer | |
Method | NA | |
Concentration | 16 mM | |
pH | 8 | |
Temperature | Room temperature | |
Incubation Period | several weeks | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanoparticles | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |