Welcome to Entry Card of Peptide
Details of SAPdb ID 1886 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1886 | |
| PMID | 27841381 | |
| Year | 2016 | |
| Name | dipeptide diPhenylalanine (FF) | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM and SEM | |
| Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP)/sodium phosphate buffer | |
| Method | NA | |
| Concentration | 16 mM | |
| pH | 8 | |
| Temperature | Room temperature | |
| Incubation Period | several weeks | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanoparticles | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |